| Name |
4-bromo-1-{5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}-1H-pyrazole
|
| Molecular Formula |
C9H7BrN6
|
| Molecular Weight |
279.10
|
| Smiles |
Cc1cc(-n2cc(Br)cn2)n2ncnc2n1
|
Cc1cc(-n2cc(Br)cn2)n2ncnc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.