| Name |
2-[4-(aminomethyl)-1H-1,2,3-triazol-1-yl]-N,N-dipropylacetamide
|
| Molecular Formula |
C11H21N5O
|
| Molecular Weight |
239.32
|
| Smiles |
CCCN(CCC)C(=O)Cn1cc(CN)nn1
|
CCCN(CCC)C(=O)Cn1cc(CN)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.