| Name |
Ethyl 2-(3-isopropoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzylamino)nicotinate
|
| Molecular Formula |
C24H33BN2O5
|
| Molecular Weight |
440.3
|
| Smiles |
CCOC(=O)c1cccnc1NCc1cc(OC(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1
|
CCOC(=O)c1cccnc1NCc1cc(OC(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.