| Name |
Benzoic acid, 5-fluoro-2-nitro-, 2-methoxyethyl ester
|
| Molecular Formula |
C10H10FNO5
|
| Molecular Weight |
243.19
|
| Smiles |
COCCOC(=O)c1cc(F)ccc1[N+](=O)[O-]
|
COCCOC(=O)c1cc(F)ccc1[N+](=O)[O-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.