| Name |
5-Nitro-1H-benzo[d][1,3]oxazin-2(4H)-one
|
| Molecular Formula |
C8H6N2O4
|
| Molecular Weight |
194.14
|
| Smiles |
O=C1Nc2cccc([N+](=O)[O-])c2CO1
|
O=C1Nc2cccc([N+](=O)[O-])c2CO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.