| Name |
2-(3-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ureido)acetic acid
|
| Molecular Formula |
C15H21BN2O5
|
| Molecular Weight |
320.15
|
| Smiles |
CC1(C)OB(c2ccc(NC(=O)NCC(=O)O)cc2)OC1(C)C
|
CC1(C)OB(c2ccc(NC(=O)NCC(=O)O)cc2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.