| Name |
5-Bromo-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3,4-dihydropyrimidin-4-one
|
| Molecular Formula |
C8H7BrN4O2
|
| Molecular Weight |
271.07
|
| Smiles |
Cc1noc(Cn2cncc(Br)c2=O)n1
|
Cc1noc(Cn2cncc(Br)c2=O)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.