| Name |
8-(2-Chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine
|
| Molecular Formula |
C12H13ClN4
|
| Molecular Weight |
248.71
|
| Smiles |
Nc1nc2n(n1)CCCC2c1ccccc1Cl
|
Nc1nc2n(n1)CCCC2c1ccccc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.