| Name |
Methyl 6-amino-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
|
| Molecular Formula |
C8H11N3O4
|
| Molecular Weight |
213.19
|
| Smiles |
COC(=O)c1c(N)n(C)c(=O)n(C)c1=O
|
COC(=O)c1c(N)n(C)c(=O)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.