| Name |
3-(1-methyl-1H-1,3-benzodiazol-2-yl)aniline hydrochloride
|
| Molecular Formula |
C14H14ClN3
|
| Molecular Weight |
259.73
|
| Smiles |
Cl.Cn1c(-c2cccc(N)c2)nc2ccccc21
|
Cl.Cn1c(-c2cccc(N)c2)nc2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.