| Name |
N-(1-Cyano-2-methylpropyl)-2-{2,5-dioxo-2',3'-dihydrospiro[imidazolidine-4,1'-inden]-1-YL}acetamide
|
| Molecular Formula |
C18H20N4O3
|
| Molecular Weight |
340.4
|
| Smiles |
CC(C)C(C#N)NC(=O)CN1C(=O)NC2(CCc3ccccc32)C1=O
|
CC(C)C(C#N)NC(=O)CN1C(=O)NC2(CCc3ccccc32)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.