| Name |
2-Chloro-1-{4-[(4-methylphenyl)methyl]-1,4-diazepan-1-yl}ethan-1-one hydrochloride
|
| Molecular Formula |
C15H22Cl2N2O
|
| Molecular Weight |
317.3
|
| Smiles |
Cc1ccc(CN2CCCN(C(=O)CCl)CC2)cc1.Cl
|
Cc1ccc(CN2CCCN(C(=O)CCl)CC2)cc1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.