| Name |
1-{5-[(Dimethylamino)methyl]-1,2,4-oxadiazol-3-yl}cyclopentan-1-amine dihydrochloride
|
| Molecular Formula |
C10H20Cl2N4O
|
| Molecular Weight |
283.20
|
| Smiles |
CN(C)Cc1nc(C2(N)CCCC2)no1.Cl.Cl
|
CN(C)Cc1nc(C2(N)CCCC2)no1.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.