| Name |
1H-Benzimidazol-2-amine, 6-bromo-N,N-dimethyl-
|
| Molecular Formula |
C9H10BrN3
|
| Molecular Weight |
240.10
|
| Smiles |
CN(C)c1nc2ccc(Br)cc2[nH]1
|
CN(C)c1nc2ccc(Br)cc2[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.