| Name |
1-[(5-Ethyl-1,3,4-oxadiazol-2-yl)methyl]-5-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione
|
| Molecular Formula |
C10H12N4O3
|
| Molecular Weight |
236.23
|
| Smiles |
CCc1nnc(Cn2cc(C)c(=O)[nH]c2=O)o1
|
CCc1nnc(Cn2cc(C)c(=O)[nH]c2=O)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.