| Name |
(S)-3-(Fmoc-amino)-4,4-diphenyl-butyric acid
|
| Molecular Formula |
C31H27NO4
|
| Molecular Weight |
477.5
|
| Smiles |
O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(c1ccccc1)c1ccccc1
|
O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(c1ccccc1)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.