| Name |
S-[(2S)-Butan-2-yl] O-ethyl (R)-(2-oxo-1,3-thiazolidin-3-yl)phosphonothioate
|
| Molecular Formula |
C9H18NO3PS2
|
| Molecular Weight |
283.4
|
| Smiles |
CCOP(=O)(SC(C)CC)N1CCSC1=O
|
CCOP(=O)(SC(C)CC)N1CCSC1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.