| Name |
1(2H)-Isoquinolinone, 7-mercapto-2-(2,2,2-trifluoroethyl)-
|
| Molecular Formula |
C11H8F3NOS
|
| Molecular Weight |
259.25
|
| Smiles |
O=c1c2cc(S)ccc2ccn1CC(F)(F)F
|
O=c1c2cc(S)ccc2ccn1CC(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.