| Name |
8-(3-Bromophenyl)-3,3-difluoro-8-pyridin-4-yl-2,3,4,8-tetrahydroimidazo[1,5-a]pyrimidin-6-amine
|
| Molecular Formula |
C17H14BrF2N5
|
| Molecular Weight |
406.2
|
| Smiles |
NC1=NC(c2ccncc2)(c2cccc(Br)c2)C2=NCC(F)(F)CN12
|
NC1=NC(c2ccncc2)(c2cccc(Br)c2)C2=NCC(F)(F)CN12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.