| Name |
1,1-Dimethylethyl (2S,4E)-2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-4-ethylidene-1-pyrrolidinecarboxylate
|
| Molecular Formula |
C18H35NO3Si
|
| Molecular Weight |
341.6
|
| Smiles |
CC=C1CC(CO[Si](C)(C)C(C)(C)C)N(C(=O)OC(C)(C)C)C1
|
CC=C1CC(CO[Si](C)(C)C(C)(C)C)N(C(=O)OC(C)(C)C)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.