| Name |
6-chloro-N-{[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methyl}pyridine-3-carboxamide
|
| Molecular Formula |
C15H11ClFN5O
|
| Molecular Weight |
331.73
|
| Smiles |
O=C(NCc1nc(-c2ccc(F)cc2)n[nH]1)c1ccc(Cl)nc1
|
O=C(NCc1nc(-c2ccc(F)cc2)n[nH]1)c1ccc(Cl)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.