| Name |
(S)-N-Cbz-aspartic acid semialdehyde
|
| Molecular Formula |
C12H13NO5
|
| Molecular Weight |
251.23
|
| Smiles |
O=CCC(NC(=O)OCc1ccccc1)C(=O)O
|
O=CCC(NC(=O)OCc1ccccc1)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.