| Name |
N-(1-cyanocyclohexyl)-2-({5H,6H,7H,8H-[1,2,4]triazolo[1,5-a]pyridin-6-yl}amino)acetamide
|
| Molecular Formula |
C15H22N6O
|
| Molecular Weight |
302.37
|
| Smiles |
N#CC1(NC(=O)CNC2CCc3ncnn3C2)CCCCC1
|
N#CC1(NC(=O)CNC2CCc3ncnn3C2)CCCCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.