| Name |
2-(2-furyl)-7,8,9,10-tetrahydro-6H-cyclohepta[e][1,2,4]triazolo[1,5-a]pyrimidine
|
| Molecular Formula |
C14H14N4O
|
| Molecular Weight |
254.29
|
| Smiles |
c1coc(-c2nc3ncc4c(n3n2)CCCCC4)c1
|
c1coc(-c2nc3ncc4c(n3n2)CCCCC4)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.