| Name |
4-[3-(Trifluoromethyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]aniline
|
| Molecular Formula |
C10H6F3N5S
|
| Molecular Weight |
285.25
|
| Smiles |
Nc1ccc(-c2nn3c(C(F)(F)F)nnc3s2)cc1
|
Nc1ccc(-c2nn3c(C(F)(F)F)nnc3s2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.