| Name |
8-Bromo-4,5-dihydrobenzo[b]thieno[2,3-d]oxepine-2-carboxylic acid
|
| Molecular Formula |
C13H9BrO3S
|
| Molecular Weight |
325.18
|
| Smiles |
O=C(O)c1cc2c(s1)-c1ccc(Br)cc1OCC2
|
O=C(O)c1cc2c(s1)-c1ccc(Br)cc1OCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.