| Name |
7-Chloro-5-fluoro-2,3-dihydro-2,2-dimethyl-4H-1,3-benzoxazin-4-one
|
| Molecular Formula |
C10H9ClFNO2
|
| Molecular Weight |
229.63
|
| Smiles |
CC1(C)NC(=O)c2c(F)cc(Cl)cc2O1
|
CC1(C)NC(=O)c2c(F)cc(Cl)cc2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.