| Name |
ethyl 2-{[3-(6-chloro-1H-indol-1-yl)propanoyl]amino}-4-methyl-1,3-thiazole-5-carboxylate
|
| Molecular Formula |
C18H18ClN3O3S
|
| Molecular Weight |
391.9
|
| Smiles |
CCOC(=O)c1sc(NC(=O)CCn2ccc3ccc(Cl)cc32)nc1C
|
CCOC(=O)c1sc(NC(=O)CCn2ccc3ccc(Cl)cc32)nc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.