| Name |
1h-Pyrazolo[4,3-c]pyridine,5-acetyl-3-(4-ethoxyphenyl)-4,5,6,7-tetrahydro-1-(phenylmethyl)-
|
| Molecular Formula |
C23H25N3O2
|
| Molecular Weight |
375.5
|
| Smiles |
CCOc1ccc(-c2nn(Cc3ccccc3)c3c2CN(C(C)=O)CC3)cc1
|
CCOc1ccc(-c2nn(Cc3ccccc3)c3c2CN(C(C)=O)CC3)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.