| Name |
N-(3,5-dimethylphenyl)-2-{4-[(3-methoxyphenyl)sulfanyl]-1-oxo-1H,2H-[1,2,4]triazolo[4,3-a]quinoxalin-2-yl}acetamide
|
| Molecular Formula |
C26H23N5O3S
|
| Molecular Weight |
485.6
|
| Smiles |
COc1cccc(Sc2nc3ccccc3n3c(=O)n(CC(=O)Nc4cc(C)cc(C)c4)nc23)c1
|
COc1cccc(Sc2nc3ccccc3n3c(=O)n(CC(=O)Nc4cc(C)cc(C)c4)nc23)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.