| Name |
2-{[(4-fluorophenyl)methyl]sulfanyl}-3-pentyl-3H,4H-thieno[3,2-d]pyrimidin-4-one
|
| Molecular Formula |
C18H19FN2OS2
|
| Molecular Weight |
362.5
|
| Smiles |
CCCCCn1c(SCc2ccc(F)cc2)nc2ccsc2c1=O
|
CCCCCn1c(SCc2ccc(F)cc2)nc2ccsc2c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.