| Name |
2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]dec-3-yl)-N-(3,4,5-trifluorophenyl)acetamide
|
| Molecular Formula |
C17H18F3N3O3
|
| Molecular Weight |
369.34
|
| Smiles |
CN1C(=O)N(CC(=O)Nc2cc(F)c(F)c(F)c2)C(=O)C12CCCCC2
|
CN1C(=O)N(CC(=O)Nc2cc(F)c(F)c(F)c2)C(=O)C12CCCCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.