| Name |
N-(2,2-dimethyltetrahydro-2H-pyran-4-yl)-2-[(4,8,8-trimethyl-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-5-yl)oxy]acetamide
|
| Molecular Formula |
C24H31NO6
|
| Molecular Weight |
429.5
|
| Smiles |
Cc1cc(=O)oc2c3c(cc(OCC(=O)NC4CCOC(C)(C)C4)c12)OC(C)(C)CC3
|
Cc1cc(=O)oc2c3c(cc(OCC(=O)NC4CCOC(C)(C)C4)c12)OC(C)(C)CC3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.