| Name |
1,3-dihydro-1-hydroxy-2,1-benzoxaborol-6-yl N-phenylcarbamate
|
| Molecular Formula |
C14H12BNO4
|
| Molecular Weight |
269.06
|
| Smiles |
O=C(Nc1ccccc1)Oc1ccc2c(c1)B(O)OC2
|
O=C(Nc1ccccc1)Oc1ccc2c(c1)B(O)OC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.