| Name |
2,4,6,8-Tetramethylcyclotetrasiloxane-2,4,6,8-tetrapropanethiol
|
| Molecular Formula |
C16H40O4S4Si4
|
| Molecular Weight |
537.1
|
| Smiles |
C[Si]1(CCCS)O[Si](C)(CCCS)O[Si](C)(CCCS)O[Si](C)(CCCS)O1
|
C[Si]1(CCCS)O[Si](C)(CCCS)O[Si](C)(CCCS)O[Si](C)(CCCS)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.