| Name |
Carbonic acid, 1-methylethyl 2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.5]dec-3-en-4-yl ester
|
| Molecular Formula |
C22H28O5
|
| Molecular Weight |
372.5
|
| Smiles |
Cc1cc(C)c(C2=C(OC(=O)OC(C)C)C3(CCCCC3)OC2=O)c(C)c1
|
Cc1cc(C)c(C2=C(OC(=O)OC(C)C)C3(CCCCC3)OC2=O)c(C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.