| Name |
Benzoic acid, 4-(acetylamino)-3-nitro-, phenyl ester
|
| Molecular Formula |
C15H12N2O5
|
| Molecular Weight |
300.27
|
| Smiles |
CC(=O)Nc1ccc(C(=O)Oc2ccccc2)cc1[N+](=O)[O-]
|
CC(=O)Nc1ccc(C(=O)Oc2ccccc2)cc1[N+](=O)[O-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.