| Name |
1h-Indole-5-carboxamide,2,3-dihydro-n,n-bis(2-hydroxyethyl)-
|
| Molecular Formula |
C13H18N2O3
|
| Molecular Weight |
250.29
|
| Smiles |
O=C(c1ccc2c(c1)CCN2)N(CCO)CCO
|
O=C(c1ccc2c(c1)CCN2)N(CCO)CCO
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.