| Name |
N-(3-fluoropropyl)-N-(2-methoxyethyl)-8-(6-methoxypyridin-3-yl)-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine
|
| Molecular Formula |
C19H25FN6O2
|
| Molecular Weight |
388.4
|
| Smiles |
COCCN(CCCF)c1nc(C)nc2c(-c3ccc(OC)nc3)c(C)nn12
|
COCCN(CCCF)c1nc(C)nc2c(-c3ccc(OC)nc3)c(C)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.