| Name |
N,N-Dimethyl-4-{[(prop-2-en-1-yl)amino]methyl}aniline dihydrochloride
|
| Molecular Formula |
C12H20Cl2N2
|
| Molecular Weight |
263.20
|
| Smiles |
C=CCNCc1ccc(N(C)C)cc1.Cl.Cl
|
C=CCNCc1ccc(N(C)C)cc1.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.