| Name |
N-(6-chloro-4-methylbenzo[d]thiazol-2-yl)-7-(methylthio)benzo[1,2-d:4,3-d']bis(thiazole)-2-amine
|
| Molecular Formula |
C17H11ClN4S4
|
| Molecular Weight |
435.0
|
| Smiles |
CSc1nc2ccc3nc(Nc4nc5c(C)cc(Cl)cc5s4)sc3c2s1
|
CSc1nc2ccc3nc(Nc4nc5c(C)cc(Cl)cc5s4)sc3c2s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.