| Name |
1-(Benzo[d][1,3]dioxol-5-yl)-3-(5-(2,5-dichlorothiophen-3-yl)-1,3,4-oxadiazol-2-yl)urea
|
| Molecular Formula |
C14H8Cl2N4O4S
|
| Molecular Weight |
399.2
|
| Smiles |
O=C(Nc1ccc2c(c1)OCO2)Nc1nnc(-c2cc(Cl)sc2Cl)o1
|
O=C(Nc1ccc2c(c1)OCO2)Nc1nnc(-c2cc(Cl)sc2Cl)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.