| Name |
3-Pyridinecarbonitrile, 6-[(1-methylethyl)(2,2,2-trifluoroethyl)amino]-
|
| Molecular Formula |
C11H12F3N3
|
| Molecular Weight |
243.23
|
| Smiles |
CC(C)N(CC(F)(F)F)c1ccc(C#N)cn1
|
CC(C)N(CC(F)(F)F)c1ccc(C#N)cn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.