| Name |
2-{[11-(4-fluorophenyl)-3,4,6,9,10-pentaazatricyclo[7.3.0.0^{2,6}]dodeca-1(12),2,4,7,10-pentaen-5-yl]sulfanyl}-N-[2-(trifluoromethyl)phenyl]acetamide
|
| Molecular Formula |
C22H20F4N6OS
|
| Molecular Weight |
492.5
|
| Smiles |
O=C(CSC1=NNC2C3CC(c4ccc(F)cc4)NN3C=CN12)Nc1ccccc1C(F)(F)F
|
O=C(CSC1=NNC2C3CC(c4ccc(F)cc4)NN3C=CN12)Nc1ccccc1C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.