| Name |
5'-O-tert-butyldimethylsilyl-3'-O,4-N-dibenzoyl-2'-deoxycytidine
|
| Molecular Formula |
C29H35N3O6Si
|
| Molecular Weight |
549.7
|
| Smiles |
CC(C)(C)[Si](C)(C)OCC1OC(n2ccc(NC(=O)c3ccccc3)nc2=O)CC1OC(=O)c1ccccc1
|
CC(C)(C)[Si](C)(C)OCC1OC(n2ccc(NC(=O)c3ccccc3)nc2=O)CC1OC(=O)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.