| Name |
3,5-Di-tert-butyl-3'-chlorobiphenyl
|
| Molecular Formula |
C20H25Cl
|
| Molecular Weight |
300.9
|
| Smiles |
CC(C)(C)c1cc(-c2cccc(Cl)c2)cc(C(C)(C)C)c1
|
CC(C)(C)c1cc(-c2cccc(Cl)c2)cc(C(C)(C)C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.