| Name |
Potassium (R)-2-(((2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(((2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)oxy)-3-hydroxypropanoate
|
| Molecular Formula |
C15H25KO14
|
| Molecular Weight |
468.45
|
| Smiles |
O=C([O-])C(CO)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O.[K+]
|
O=C([O-])C(CO)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O.[K+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.