| Name |
2,4-Dibromo-5-(4H-1,2,4-triazol-3-yl)thiazole
|
| Molecular Formula |
C5H2Br2N4S
|
| Molecular Weight |
309.97
|
| Smiles |
Brc1nc(Br)c(-c2ncn[nH]2)s1
|
Brc1nc(Br)c(-c2ncn[nH]2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.