| Name |
4-{[5-(Methylsulfonyl)-1,3-thiazol-2-yl]carbamoyl}phenyl acetate
|
| Molecular Formula |
C13H12N2O5S2
|
| Molecular Weight |
340.4
|
| Smiles |
CC(=O)Oc1ccc(C(=O)Nc2ncc(S(C)(=O)=O)s2)cc1
|
CC(=O)Oc1ccc(C(=O)Nc2ncc(S(C)(=O)=O)s2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.