| Name |
(1-(5-Iodo-8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-2-yl)cyclopropyl)methanol
|
| Molecular Formula |
C11H12IN3O2
|
| Molecular Weight |
345.14
|
| Smiles |
COc1ccc(I)n2nc(C3(CO)CC3)nc12
|
COc1ccc(I)n2nc(C3(CO)CC3)nc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.